C7H13NO6S2 — CID 63924683
2-[(1,1-dioxothian-3-yl)sulfamoyl]acetic acid (PubChem CID 63924683) has the molecular formula C7H13NO6S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(1,1-dioxothian-3-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 63924683 |
| Molecular Formula | C7H13NO6S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[(1,1-dioxothian-3-yl)sulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO6S2/c9-7(10)5-16(13,14)8-6-2-1-3-15(11,12)4-6/h6,8H,1-5H2,(H,9,10) |
| InChIKey | OTMYZKLAKYBKBY-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |