C8H18N2O4S2 — CID 63923323
3-amino-N-(1,1-dioxothian-3-yl)propane-1-sulfonamide (PubChem CID 63923323) has the molecular formula C8H18N2O4S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothian-3-yl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-(1,1-dioxothian-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 63923323 |
| Molecular Formula | C8H18N2O4S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-amino-N-(1,1-dioxothian-3-yl)propane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H18N2O4S2/c9-4-2-6-16(13,14)10-8-3-1-5-15(11,12)7-8/h8,10H,1-7,9H2 |
| InChIKey | IDNIATMNGUYKFH-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |