C13H16N2O4S2 — CID 63922361
1-(2-cyanophenyl)-N-(1,1-dioxothian-3-yl)methanesulfonamide (PubChem CID 63922361) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(1,1-dioxothian-3-yl)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(1,1-dioxothian-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 63922361 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(1,1-dioxothian-3-yl)methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O4S2/c14-8-11-4-1-2-5-12(11)9-21(18,19)15-13-6-3-7-20(16,17)10-13/h1-2,4-5,13,15H,3,6-7,9-10H2 |
| InChIKey | HUXLNBNBYBNOJQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |