C18H25N3O4S — CID 71629903
tert-butyl 4-[(2-cyanophenyl)methylsulfonylamino]piperidine-1-carboxylate (PubChem CID 71629903) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl 4-[(2-cyanophenyl)methylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-cyanophenyl)methylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71629903 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl 4-[(2-cyanophenyl)methylsulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)Cc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C18H25N3O4S/c1-18(2,3)25-17(22)21-10-8-16(9-11-21)20-26(23,24)13-15-7-5-4-6-14(15)12-19/h4-7,16,20H,8-11,13H2,1-3H3 |
| InChIKey | OOADAEQWJOWBOB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |