C18H23N3O4 — CID 96510525
tert-butyl (3S)-3-[[2-(2-cyanophenoxy)acetyl]amino]pyrrolidine-1-carboxylate (PubChem CID 96510525) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-(2-cyanophenoxy)acetyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[2-(2-cyanophenoxy)acetyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 96510525 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl (3S)-3-[[2-(2-cyanophenoxy)acetyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](NC(=O)COc2ccccc2C#N)C1 |
| InChI | InChI=1S/C18H23N3O4/c1-18(2,3)25-17(23)21-9-8-14(11-21)20-16(22)12-24-15-7-5-4-6-13(15)10-19/h4-7,14H,8-9,11-12H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | ZMMXFHUBXXJDRL-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |