C16H22N2O2S — CID 63997155
1-(2-cyanophenyl)-N-(2,4-dimethylcyclohexyl)methanesulfonamide (PubChem CID 63997155) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(2,4-dimethylcyclohexyl)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(2,4-dimethylcyclohexyl)methanesulfonamide |
|---|---|
| PubChem CID | 63997155 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(2,4-dimethylcyclohexyl)methanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)Cc2ccccc2C#N)C(C)C1 |
| InChI | InChI=1S/C16H22N2O2S/c1-12-7-8-16(13(2)9-12)18-21(19,20)11-15-6-4-3-5-14(15)10-17/h3-6,12-13,16,18H,7-9,11H2,1-2H3 |
| InChIKey | HCUOHESEJWCRTE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |