C12H26N2O4S2 — CID 106065955
N-(1,1-dioxothian-3-yl)-4-(propylamino)butane-1-sulfonamide (PubChem CID 106065955) has the molecular formula C12H26N2O4S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106065955 |
| Molecular Formula | C12H26N2O4S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H26N2O4S2/c1-2-7-13-8-3-4-10-20(17,18)14-12-6-5-9-19(15,16)11-12/h12-14H,2-11H2,1H3 |
| InChIKey | MMDZCMMNTUAELY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|