C14H29NO2S — CID 63923728
N-nonyl-1,1-dioxothian-3-amine (PubChem CID 63923728) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is N-nonyl-1,1-dioxothian-3-amine.
| Compound Name | N-nonyl-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63923728 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-nonyl-1,1-dioxothian-3-amine |
| SMILES | CCCCCCCCCNC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H29NO2S/c1-2-3-4-5-6-7-8-11-15-14-10-9-12-18(16,17)13-14/h14-15H,2-13H2,1H3 |
| InChIKey | XUBUPULIOMSARM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|