C14H29NO5S — CID 63922339
1-(2-butoxyethoxy)-3-[(1,1-dioxothian-3-yl)amino]propan-2-ol (PubChem CID 63922339) has the molecular formula C14H29NO5S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)-3-[(1,1-dioxothian-3-yl)amino]propan-2-ol.
| Compound Name | 1-(2-butoxyethoxy)-3-[(1,1-dioxothian-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 63922339 |
| Molecular Formula | C14H29NO5S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(2-butoxyethoxy)-3-[(1,1-dioxothian-3-yl)amino]propan-2-ol |
| SMILES | CCCCOCCOCC(O)CNC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H29NO5S/c1-2-3-6-19-7-8-20-11-14(16)10-15-13-5-4-9-21(17,18)12-13/h13-16H,2-12H2,1H3 |
| InChIKey | WPJVFISCEUMGHJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|