C11H21NO4S — CID 63923737
butyl 2-[(1,1-dioxothian-3-yl)amino]acetate (PubChem CID 63923737) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is butyl 2-[(1,1-dioxothian-3-yl)amino]acetate.
| Compound Name | butyl 2-[(1,1-dioxothian-3-yl)amino]acetate |
|---|---|
| PubChem CID | 63923737 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | butyl 2-[(1,1-dioxothian-3-yl)amino]acetate |
| SMILES | CCCCOC(=O)CNC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-2-3-6-16-11(13)8-12-10-5-4-7-17(14,15)9-10/h10,12H,2-9H2,1H3 |
| InChIKey | HCZKQQBXUWMSFB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|