C9H15NO5S — CID 63924377
ethyl 2-[(1,1-dioxothian-3-yl)amino]-2-oxoacetate (PubChem CID 63924377) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothian-3-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(1,1-dioxothian-3-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 63924377 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | ethyl 2-[(1,1-dioxothian-3-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO5S/c1-2-15-9(12)8(11)10-7-4-3-5-16(13,14)6-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | USQUAPUIAPXMIL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|