C14H20N2O4S — CID 63924857
3-amino-N-(1,1-dioxothian-3-yl)-4-ethoxybenzamide (PubChem CID 63924857) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothian-3-yl)-4-ethoxybenzamide.
| Compound Name | 3-amino-N-(1,1-dioxothian-3-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 63924857 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-amino-N-(1,1-dioxothian-3-yl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCCS(=O)(=O)C2)cc1N |
| InChI | InChI=1S/C14H20N2O4S/c1-2-20-13-6-5-10(8-12(13)15)14(17)16-11-4-3-7-21(18,19)9-11/h5-6,8,11H,2-4,7,9,15H2,1H3,(H,16,17) |
| InChIKey | DXSXGWKZSSOHNA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|