C9H19NO4S — CID 63923418
N-(2,2-dimethoxyethyl)-1,1-dioxothian-3-amine (PubChem CID 63923418) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63923418 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1,1-dioxothian-3-amine |
| SMILES | COC(CNC1CCCS(=O)(=O)C1)OC |
| InChI | InChI=1S/C9H19NO4S/c1-13-9(14-2)6-10-8-4-3-5-15(11,12)7-8/h8-10H,3-7H2,1-2H3 |
| InChIKey | LKXNPBQFTPWINL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|