C11H21NO2S — CID 115900871
N-(2-cyclopropylpropyl)-1,1-dioxothian-3-amine (PubChem CID 115900871) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N-(2-cyclopropylpropyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(2-cyclopropylpropyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 115900871 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(2-cyclopropylpropyl)-1,1-dioxothian-3-amine |
| SMILES | CC(CNC1CCCS(=O)(=O)C1)C1CC1 |
| InChI | InChI=1S/C11H21NO2S/c1-9(10-4-5-10)7-12-11-3-2-6-15(13,14)8-11/h9-12H,2-8H2,1H3 |
| InChIKey | UGIMPEMXBQNBEL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |