C12H25NO2S — CID 63911252
N-heptan-2-yl-1,1-dioxothian-3-amine (PubChem CID 63911252) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-heptan-2-yl-1,1-dioxothian-3-amine.
| Compound Name | N-heptan-2-yl-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63911252 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-heptan-2-yl-1,1-dioxothian-3-amine |
| SMILES | CCCCCC(C)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H25NO2S/c1-3-4-5-7-11(2)13-12-8-6-9-16(14,15)10-12/h11-13H,3-10H2,1-2H3 |
| InChIKey | BDCVIIAEEWEYDO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|