C10H21NO3S — CID 115901106
3-[(1,1-dioxothian-3-yl)amino]-2-methylbutan-1-ol (PubChem CID 115901106) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)amino]-2-methylbutan-1-ol.
| Compound Name | 3-[(1,1-dioxothian-3-yl)amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115901106 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)amino]-2-methylbutan-1-ol |
| SMILES | CC(CO)C(C)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO3S/c1-8(6-12)9(2)11-10-4-3-5-15(13,14)7-10/h8-12H,3-7H2,1-2H3 |
| InChIKey | AFYMYRBMURSWII-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |