C10H19N3O4S — CID 63923344
2-[(1,1-dioxothian-3-yl)amino]-N-(methylcarbamoyl)propanamide (PubChem CID 63923344) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)amino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[(1,1-dioxothian-3-yl)amino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 63923344 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(1,1-dioxothian-3-yl)amino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N3O4S/c1-7(9(14)13-10(15)11-2)12-8-4-3-5-18(16,17)6-8/h7-8,12H,3-6H2,1-2H3,(H2,11,13,14,15) |
| InChIKey | PUJUNRJLFSCZQT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |