C9H18N2O3S — CID 43085824
2-[(1,1-dioxothiolan-3-yl)amino]-N-ethylpropanamide (PubChem CID 43085824) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-N-ethylpropanamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 43085824 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O3S/c1-3-10-9(12)7(2)11-8-4-5-15(13,14)6-8/h7-8,11H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | CJXJYFGGVRVHAO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |