C11H21NO4S — CID 43839832
methyl 2-[(1,1-dioxothiolan-3-yl)amino]-3-methylpentanoate (PubChem CID 43839832) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-3-yl)amino]-3-methylpentanoate.
| Compound Name | methyl 2-[(1,1-dioxothiolan-3-yl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 43839832 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolan-3-yl)amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC1CCS(=O)(=O)C1)C(=O)OC |
| InChI | InChI=1S/C11H21NO4S/c1-4-8(2)10(11(13)16-3)12-9-5-6-17(14,15)7-9/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | SLOMBXUNJCKVJU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |