methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate

C15H29NO2 — CID 64753370

IUPACmethyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate
SMILESCCC(C)C(NC1CC(C)CC(C)C1)C(=O)OC
InChIInChI=1S/C15H29NO2/c1-6-12(4)14(15(17)18-5)16-13-8-10(2)7-11(3)9-13/h10-14,16H,6-9H2,1-5H3
InChIKeySVPDIZNZEPZKOS-UHFFFAOYSA-N
MW255.40 g/mol
LogP2.99
Rot. Bonds5

About methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate

methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate (PubChem CID 64753370) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate
PubChem CID64753370
Molecular FormulaC15H29NO2
Molecular Weight255.40 g/mol
Exact Mass255.22
IUPAC Namemethyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate
SMILESCCC(C)C(NC1CC(C)CC(C)C1)C(=O)OC
InChIInChI=1S/C15H29NO2/c1-6-12(4)14(15(17)18-5)16-13-8-10(2)7-11(3)9-13/h10-14,16H,6-9H2,1-5H3
InChIKeySVPDIZNZEPZKOS-UHFFFAOYSA-N
XLogP2.99
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.40
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate?
The IUPAC name of methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate (CID 64753370) is methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate.
What is the SMILES notation for methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate?
The canonical SMILES for methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate is CCC(C)C(NC1CC(C)CC(C)C1)C(=O)OC.
What is the InChIKey of methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate?
The InChIKey is SVPDIZNZEPZKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-6-12(4)14(15(17)18-5)16-13-8-10(2)7-11(3)9-13/h10-14,16H,6-9H2,1-5H3.
What are the key properties of methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate?
methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate has a molecular weight of 255.40 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dimethylcyclohexyl)amino]-3-methylpentanoate is sourced from PubChem (CID 64753370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).