C10H20N2O4S — CID 43086730
2-[(1,1-dioxothiolan-3-yl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 43086730) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 43086730 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O4S/c1-8(10(13)11-4-5-16-2)12-9-3-6-17(14,15)7-9/h8-9,12H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | RGVUXHGRFFZIAY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|