C11H20N2O3S — CID 63923148
2-[(1,1-dioxothian-3-yl)amino]-N-prop-2-enylpropanamide (PubChem CID 63923148) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)amino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(1,1-dioxothian-3-yl)amino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 63923148 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[(1,1-dioxothian-3-yl)amino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-3-6-12-11(14)9(2)13-10-5-4-7-17(15,16)8-10/h3,9-10,13H,1,4-8H2,2H3,(H,12,14) |
| InChIKey | OONXYHREYDHWNP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|