C13H24N2O — CID 115880295
2-[(3,3-dimethylcyclopentyl)amino]-N-prop-2-enylpropanamide (PubChem CID 115880295) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclopentyl)amino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(3,3-dimethylcyclopentyl)amino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 115880295 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-[(3,3-dimethylcyclopentyl)amino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C13H24N2O/c1-5-8-14-12(16)10(2)15-11-6-7-13(3,4)9-11/h5,10-11,15H,1,6-9H2,2-4H3,(H,14,16) |
| InChIKey | MBPKNICIEQGPPF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|