C10H20N2O — CID 130676096
(2R)-2-[(3,3-dimethylcyclopentyl)amino]propanamide (PubChem CID 130676096) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (2R)-2-[(3,3-dimethylcyclopentyl)amino]propanamide.
| Compound Name | (2R)-2-[(3,3-dimethylcyclopentyl)amino]propanamide |
|---|---|
| PubChem CID | 130676096 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (2R)-2-[(3,3-dimethylcyclopentyl)amino]propanamide |
| SMILES | C[C@@H](NC1CCC(C)(C)C1)C(N)=O |
| InChI | InChI=1S/C10H20N2O/c1-7(9(11)13)12-8-4-5-10(2,3)6-8/h7-8,12H,4-6H2,1-3H3,(H2,11,13)/t7-,8?/m1/s1 |
| InChIKey | PGIWIBKZXBVIOB-GVHYBUMESA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |