C9H18N2O — CID 130678752
(2R)-2-[(3,3-dimethylcyclobutyl)amino]propanamide (PubChem CID 130678752) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (2R)-2-[(3,3-dimethylcyclobutyl)amino]propanamide.
| Compound Name | (2R)-2-[(3,3-dimethylcyclobutyl)amino]propanamide |
|---|---|
| PubChem CID | 130678752 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (2R)-2-[(3,3-dimethylcyclobutyl)amino]propanamide |
| SMILES | C[C@@H](NC1CC(C)(C)C1)C(N)=O |
| InChI | InChI=1S/C9H18N2O/c1-6(8(10)12)11-7-4-9(2,3)5-7/h6-7,11H,4-5H2,1-3H3,(H2,10,12)/t6-/m1/s1 |
| InChIKey | JYNNMKQEEUQEOW-ZCFIWIBFSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |