C6H12N2O — CID 28835909
(2S)-2-(cyclopropylamino)propanamide (PubChem CID 28835909) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is (2S)-2-(cyclopropylamino)propanamide.
| Compound Name | (2S)-2-(cyclopropylamino)propanamide |
|---|---|
| PubChem CID | 28835909 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (2S)-2-(cyclopropylamino)propanamide |
| SMILES | C[C@H](NC1CC1)C(N)=O |
| InChI | InChI=1S/C6H12N2O/c1-4(6(7)9)8-5-2-3-5/h4-5,8H,2-3H2,1H3,(H2,7,9)/t4-/m0/s1 |
| InChIKey | MLSDMYMJYJSAIQ-BYPYZUCNSA-N |
| XLogP | -0.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |