C8H14BrNO4S — CID 103231379
methyl 2-bromo-3-[(1,1-dioxothiolan-3-yl)amino]propanoate (PubChem CID 103231379) has the molecular formula C8H14BrNO4S and a molecular weight of 300.17 g/mol. Its IUPAC name is methyl 2-bromo-3-[(1,1-dioxothiolan-3-yl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(1,1-dioxothiolan-3-yl)amino]propanoate |
|---|---|
| PubChem CID | 103231379 |
| Molecular Formula | C8H14BrNO4S |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | methyl 2-bromo-3-[(1,1-dioxothiolan-3-yl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14BrNO4S/c1-14-8(11)7(9)4-10-6-2-3-15(12,13)5-6/h6-7,10H,2-5H2,1H3 |
| InChIKey | VNSZYUJFBUFCHP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|