C7H13NO5S — CID 4263871
2-[(1,1-dioxothiolan-3-yl)amino]-3-hydroxypropanoic acid (PubChem CID 4263871) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 4263871 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(CO)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO5S/c9-3-6(7(10)11)8-5-1-2-14(12,13)4-5/h5-6,8-9H,1-4H2,(H,10,11) |
| InChIKey | KGUCYQIJUNRGFV-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |