C9H16N2O6S — CID 61201461
2-[(1,1-dioxothian-4-yl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 61201461) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61201461 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)NC(CO)C(=O)O |
| InChI | InChI=1S/C9H16N2O6S/c12-5-7(8(13)14)11-9(15)10-6-1-3-18(16,17)4-2-6/h6-7,12H,1-5H2,(H,13,14)(H2,10,11,15) |
| InChIKey | AAAATGKLDRDZAW-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |