C9H16N2O5 — CID 80756963
(2R)-3-hydroxy-2-(oxan-4-ylcarbamoylamino)propanoic acid (PubChem CID 80756963) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-(oxan-4-ylcarbamoylamino)propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-(oxan-4-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 80756963 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2R)-3-hydroxy-2-(oxan-4-ylcarbamoylamino)propanoic acid |
| SMILES | O=C(NC1CCOCC1)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c12-5-7(8(13)14)11-9(15)10-6-1-3-16-4-2-6/h6-7,12H,1-5H2,(H,13,14)(H2,10,11,15)/t7-/m1/s1 |
| InChIKey | DTMITZMJHJSAQL-SSDOTTSWSA-N |
| XLogP | -1.09 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |