C9H16N2O3S — CID 115673028
1-cyclopropyl-3-(1,1-dioxothian-4-yl)urea (PubChem CID 115673028) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,1-dioxothian-4-yl)urea.
| Compound Name | 1-cyclopropyl-3-(1,1-dioxothian-4-yl)urea |
|---|---|
| PubChem CID | 115673028 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-cyclopropyl-3-(1,1-dioxothian-4-yl)urea |
| SMILES | O=C(NC1CC1)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16N2O3S/c12-9(10-7-1-2-7)11-8-3-5-15(13,14)6-4-8/h7-8H,1-6H2,(H2,10,11,12) |
| InChIKey | WJFMHWGNSKKKHI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |