C10H20N2O3S — CID 115585815
1-butyl-3-(1,1-dioxothian-4-yl)urea (PubChem CID 115585815) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-butyl-3-(1,1-dioxothian-4-yl)urea.
| Compound Name | 1-butyl-3-(1,1-dioxothian-4-yl)urea |
|---|---|
| PubChem CID | 115585815 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-butyl-3-(1,1-dioxothian-4-yl)urea |
| SMILES | CCCCNC(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-2-3-6-11-10(13)12-9-4-7-16(14,15)8-5-9/h9H,2-8H2,1H3,(H2,11,12,13) |
| InChIKey | PGQADLTXQKCSIX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|