C10H20N2O3S — CID 97027617
1-butyl-3-[[(2S)-1,1-dioxothiolan-2-yl]methyl]urea (PubChem CID 97027617) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-butyl-3-[[(2S)-1,1-dioxothiolan-2-yl]methyl]urea.
| Compound Name | 1-butyl-3-[[(2S)-1,1-dioxothiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97027617 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-butyl-3-[[(2S)-1,1-dioxothiolan-2-yl]methyl]urea |
| SMILES | CCCCNC(=O)NC[C@@H]1CCCS1(=O)=O |
| InChI | InChI=1S/C10H20N2O3S/c1-2-3-6-11-10(13)12-8-9-5-4-7-16(9,14)15/h9H,2-8H2,1H3,(H2,11,12,13)/t9-/m0/s1 |
| InChIKey | CDULWXVBIVWIMS-VIFPVBQESA-N |
| XLogP | 0.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|