C10H22N4O2S — CID 104887516
1-amino-3-butyl-2-[(1,1-dioxothiolan-2-yl)methyl]guanidine (PubChem CID 104887516) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-amino-3-butyl-2-[(1,1-dioxothiolan-2-yl)methyl]guanidine.
| Compound Name | 1-amino-3-butyl-2-[(1,1-dioxothiolan-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104887516 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-amino-3-butyl-2-[(1,1-dioxothiolan-2-yl)methyl]guanidine |
| SMILES | CCCCN/C(=N\CC1CCCS1(=O)=O)NN |
| InChI | InChI=1S/C10H22N4O2S/c1-2-3-6-12-10(14-11)13-8-9-5-4-7-17(9,15)16/h9H,2-8,11H2,1H3,(H2,12,13,14) |
| InChIKey | GKGXRYCQSHIFSR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|