C10H22N4O — CID 104882633
1-amino-3-butyl-2-(oxolan-3-ylmethyl)guanidine (PubChem CID 104882633) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-amino-3-butyl-2-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-amino-3-butyl-2-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104882633 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 1-amino-3-butyl-2-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCCCN/C(=N\CC1CCOC1)NN |
| InChI | InChI=1S/C10H22N4O/c1-2-3-5-12-10(14-11)13-7-9-4-6-15-8-9/h9H,2-8,11H2,1H3,(H2,12,13,14) |
| InChIKey | HBMPGLHFKOQZBJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|