C9H20N4O — CID 104886091
1-amino-3-ethyl-2-(oxan-4-ylmethyl)guanidine (PubChem CID 104886091) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-amino-3-ethyl-2-(oxan-4-ylmethyl)guanidine.
| Compound Name | 1-amino-3-ethyl-2-(oxan-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104886091 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-amino-3-ethyl-2-(oxan-4-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCOCC1)NN |
| InChI | InChI=1S/C9H20N4O/c1-2-11-9(13-10)12-7-8-3-5-14-6-4-8/h8H,2-7,10H2,1H3,(H2,11,12,13) |
| InChIKey | AZVFZEYWVOQUSE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|