C8H16F2N4 — CID 130878893
1-amino-2-[(3,3-difluorocyclobutyl)methyl]-3-ethylguanidine (PubChem CID 130878893) has the molecular formula C8H16F2N4 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-amino-2-[(3,3-difluorocyclobutyl)methyl]-3-ethylguanidine.
| Compound Name | 1-amino-2-[(3,3-difluorocyclobutyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 130878893 |
| Molecular Formula | C8H16F2N4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-amino-2-[(3,3-difluorocyclobutyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CC(F)(F)C1)NN |
| InChI | InChI=1S/C8H16F2N4/c1-2-12-7(14-11)13-5-6-3-8(9,10)4-6/h6H,2-5,11H2,1H3,(H2,12,13,14) |
| InChIKey | FYICUSBQRGLECV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|