C7H17N5O — CID 104883987
N-ethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide (PubChem CID 104883987) has the molecular formula C7H17N5O and a molecular weight of 187.25 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide.
| Compound Name | N-ethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 104883987 |
| Molecular Formula | C7H17N5O |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-ethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide |
| SMILES | CCNC(=O)C/N=C(/NN)NCC |
| InChI | InChI=1S/C7H17N5O/c1-3-9-6(13)5-11-7(12-8)10-4-2/h3-5,8H2,1-2H3,(H,9,13)(H2,10,11,12) |
| InChIKey | MHYGSRDOLKXDGV-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|