C10H23N5O — CID 104888447
2-[[hydrazinyl(propylamino)methylidene]amino]-N-(2-methylpropyl)acetamide (PubChem CID 104888447) has the molecular formula C10H23N5O and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-[[hydrazinyl(propylamino)methylidene]amino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[[hydrazinyl(propylamino)methylidene]amino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 104888447 |
| Molecular Formula | C10H23N5O |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 2-[[hydrazinyl(propylamino)methylidene]amino]-N-(2-methylpropyl)acetamide |
| SMILES | CCCN/C(=N\CC(=O)NCC(C)C)NN |
| InChI | InChI=1S/C10H23N5O/c1-4-5-12-10(15-11)14-7-9(16)13-6-8(2)3/h8H,4-7,11H2,1-3H3,(H,13,16)(H2,12,14,15) |
| InChIKey | GMOKHIKFUCBNDK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|