C12H27IN4O2 — CID 111180944
2-[[ethylamino-(2-methylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111180944) has the molecular formula C12H27IN4O2 and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-[[ethylamino-(2-methylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(2-methylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111180944 |
| Molecular Formula | C12H27IN4O2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[ethylamino-(2-methylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)NCC(C)C.I |
| InChI | InChI=1S/C12H26N4O2.HI/c1-5-13-12(15-8-10(2)3)16-9-11(17)14-6-7-18-4;/h10H,5-9H2,1-4H3,(H,14,17)(H2,13,15,16);1H |
| InChIKey | LCIVADDZUPXEHW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|