C19H33IN4O4 — CID 109493774
2-[[ethylamino-[[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 109493774) has the molecular formula C19H33IN4O4 and a molecular weight of 508.40 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109493774 |
| Molecular Formula | C19H33IN4O4 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-[[ethylamino-[[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C19H32N4O4.HI/c1-5-20-19(23-13-18(25)21-10-11-26-4)22-12-17(24)15-6-8-16(9-7-15)27-14(2)3;/h6-9,14,17,24H,5,10-13H2,1-4H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | RXAUVCYNPSLQTG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|