C20H31IN4O3 — CID 109493710
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109493710) has the molecular formula C20H31IN4O3 and a molecular weight of 502.40 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493710 |
| Molecular Formula | C20H31IN4O3 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C20H30N4O3.HI/c1-6-21-20(23-12-19-24-14(4)15(5)27-19)22-11-18(25)16-7-9-17(10-8-16)26-13(2)3;/h7-10,13,18,25H,6,11-12H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | JMVGMNMTTDCMFH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|