C19H30IN5O2 — CID 109493532
1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109493532) has the molecular formula C19H30IN5O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493532 |
| Molecular Formula | C19H30IN5O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(C)c1)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C19H29N5O2.HI/c1-5-20-19(21-10-15-11-23-24(4)13-15)22-12-18(25)16-6-8-17(9-7-16)26-14(2)3;/h6-9,11,13-14,18,25H,5,10,12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | GKPUSLDEDCQQOS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|