C25H34IN5O2 — CID 109493594
2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109493594) has the molecular formula C25H34IN5O2 and a molecular weight of 563.48 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493594 |
| Molecular Formula | C25H34IN5O2 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(Cc2ccccc2)c1)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C25H33N5O2.HI/c1-4-26-25(28-16-24(31)22-10-12-23(13-11-22)32-19(2)3)27-14-21-15-29-30(18-21)17-20-8-6-5-7-9-20;/h5-13,15,18-19,24,31H,4,14,16-17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | HDMNFYGJJGPKIR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|