C26H36IN5O2 — CID 109494202
2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109494202) has the molecular formula C26H36IN5O2 and a molecular weight of 577.51 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109494202 |
| Molecular Formula | C26H36IN5O2 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(-c2ccccc2)c1C)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C26H35N5O2.HI/c1-6-27-26(29-17-25(32)21-12-14-23(15-13-21)33-18(2)3)28-16-24-19(4)30-31(20(24)5)22-10-8-7-9-11-22;/h7-15,18,25,32H,6,16-17H2,1-5H3,(H2,27,28,29);1H |
| InChIKey | OWICKKLGYKVHND-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|