C24H31IN4O2 — CID 109494468
1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-(quinolin-4-ylmethyl)guanidine;hydroiodide (PubChem CID 109494468) has the molecular formula C24H31IN4O2 and a molecular weight of 534.44 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-(quinolin-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-(quinolin-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109494468 |
| Molecular Formula | C24H31IN4O2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-(quinolin-4-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc2ccccc12)NCC(O)c1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C24H30N4O2.HI/c1-4-25-24(27-15-19-13-14-26-22-8-6-5-7-21(19)22)28-16-23(29)18-9-11-20(12-10-18)30-17(2)3;/h5-14,17,23,29H,4,15-16H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | QVCFVVUAQGZSSV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|