C19H25F2IN4O3 — CID 109494840
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109494840) has the molecular formula C19H25F2IN4O3 and a molecular weight of 522.33 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109494840 |
| Molecular Formula | C19H25F2IN4O3 |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(2-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OC)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C19H24F2N4O3.HI/c1-3-22-19(24-11-14-5-4-10-23-17(14)27-2)25-12-16(26)13-6-8-15(9-7-13)28-18(20)21;/h4-10,16,18,26H,3,11-12H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | OSNAOGZYANETTQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|