C22H25F2IN4O3 — CID 109495268
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109495268) has the molecular formula C22H25F2IN4O3 and a molecular weight of 558.37 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495268 |
| Molecular Formula | C22H25F2IN4O3 |
| Molecular Weight | 558.37 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)o1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C22H24F2N4O3.HI/c1-2-25-22(27-12-18(29)15-8-10-17(11-9-15)30-21(23)24)28-14-20-26-13-19(31-20)16-6-4-3-5-7-16;/h3-11,13,18,21,29H,2,12,14H2,1H3,(H2,25,27,28);1H |
| InChIKey | POPHRTMSJNLDSX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|