C24H27F2IN4O2 — CID 109495002
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 109495002) has the molecular formula C24H27F2IN4O2 and a molecular weight of 568.41 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495002 |
| Molecular Formula | C24H27F2IN4O2 |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ccccn2)c1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C24H26F2N4O2.HI/c1-2-27-24(30-16-22(31)18-9-11-20(12-10-18)32-23(25)26)29-15-17-6-5-7-19(14-17)21-8-3-4-13-28-21;/h3-14,22-23,31H,2,15-16H2,1H3,(H2,27,29,30);1H |
| InChIKey | JRDJNMBJIXDMHC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|