C22H24F2N4O3 — CID 109495293
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine (PubChem CID 109495293) has the molecular formula C22H24F2N4O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109495293 |
| Molecular Formula | C22H24F2N4O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H24F2N4O3/c1-2-25-22(26-13-17-12-20(31-28-17)16-6-4-3-5-7-16)27-14-19(29)15-8-10-18(11-9-15)30-21(23)24/h3-12,19,21,29H,2,13-14H2,1H3,(H2,25,26,27) |
| InChIKey | ZWDZHHXFRAJQJP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|